C53H48N2O5P4 — CID 164745970
1,1,3,3-tetrakis(diphenylphosphorylmethyl)urea (PubChem CID 164745970) has the molecular formula C53H48N2O5P4 and a molecular weight of 916.87 g/mol. Its IUPAC name is 1,1,3,3-tetrakis(diphenylphosphorylmethyl)urea.
| Compound Name | 1,1,3,3-tetrakis(diphenylphosphorylmethyl)urea |
|---|---|
| PubChem CID | 164745970 |
| Molecular Formula | C53H48N2O5P4 |
| Molecular Weight | 916.87 g/mol |
| Exact Mass | 916.25 |
| IUPAC Name | 1,1,3,3-tetrakis(diphenylphosphorylmethyl)urea |
| SMILES | O=C(N(CP(=O)(c1ccccc1)c1ccccc1)CP(=O)(c1ccccc1)c1ccccc1)N(CP(=O)(c1ccccc1)c1ccccc1)CP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C53H48N2O5P4/c56-53(54(41-61(57,45-25-9-1-10-26-45)46-27-11-2-12-28-46)42-62(58,47-29-13-3-14-30-47)48-31-15-4-16-32-48)55(43-63(59,49-33-17-5-18-34-49)50-35-19-6-20-36-50)44-64(60,51-37-21-7-22-38-51)52-39-23-8-24-40-52/h1-40H,41-44H2 |
| InChIKey | SBBXYIKAUOVZGE-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 916.87 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|