C27H26N2O3P2 — CID 164746016
1,3-bis(diphenylphosphorylmethyl)urea (PubChem CID 164746016) has the molecular formula C27H26N2O3P2 and a molecular weight of 488.46 g/mol. Its IUPAC name is 1,3-bis(diphenylphosphorylmethyl)urea.
| Compound Name | 1,3-bis(diphenylphosphorylmethyl)urea |
|---|---|
| PubChem CID | 164746016 |
| Molecular Formula | C27H26N2O3P2 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | 1,3-bis(diphenylphosphorylmethyl)urea |
| SMILES | O=C(NCP(=O)(c1ccccc1)c1ccccc1)NCP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H26N2O3P2/c30-27(28-21-33(31,23-13-5-1-6-14-23)24-15-7-2-8-16-24)29-22-34(32,25-17-9-3-10-18-25)26-19-11-4-12-20-26/h1-20H,21-22H2,(H2,28,29,30) |
| InChIKey | KLUVSZXFOVQVHG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|