C17H20N3O2PS — CID 171365830
1-[(2-diphenylphosphorylacetyl)amino]-3-ethylthiourea (PubChem CID 171365830) has the molecular formula C17H20N3O2PS and a molecular weight of 361.41 g/mol. Its IUPAC name is 1-[(2-diphenylphosphorylacetyl)amino]-3-ethylthiourea.
| Compound Name | 1-[(2-diphenylphosphorylacetyl)amino]-3-ethylthiourea |
|---|---|
| PubChem CID | 171365830 |
| Molecular Formula | C17H20N3O2PS |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 1-[(2-diphenylphosphorylacetyl)amino]-3-ethylthiourea |
| SMILES | CCNC(=S)NNC(=O)CP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H20N3O2PS/c1-2-18-17(24)20-19-16(21)13-23(22,14-9-5-3-6-10-14)15-11-7-4-8-12-15/h3-12H,2,13H2,1H3,(H,19,21)(H2,18,20,24) |
| InChIKey | KEFPSMYCBMGZNN-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|