C5H11N3O2S — CID 53353059
1-ethyl-3-[(2-hydroxyacetyl)amino]thiourea (PubChem CID 53353059) has the molecular formula C5H11N3O2S and a molecular weight of 177.23 g/mol. Its IUPAC name is 1-ethyl-3-[(2-hydroxyacetyl)amino]thiourea.
| Compound Name | 1-ethyl-3-[(2-hydroxyacetyl)amino]thiourea |
|---|---|
| PubChem CID | 53353059 |
| Molecular Formula | C5H11N3O2S |
| Molecular Weight | 177.23 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | 1-ethyl-3-[(2-hydroxyacetyl)amino]thiourea |
| SMILES | CCNC(=S)NNC(=O)CO |
| InChI | InChI=1S/C5H11N3O2S/c1-2-6-5(11)8-7-4(10)3-9/h9H,2-3H2,1H3,(H,7,10)(H2,6,8,11) |
| InChIKey | QHUSJBURJKATPO-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 73.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.23 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|