C30H28O4P2 — CID 58792595
1,6-bis(diphenylphosphoryl)hexane-1,6-dione (PubChem CID 58792595) has the molecular formula C30H28O4P2 and a molecular weight of 514.50 g/mol. Its IUPAC name is 1,6-bis(diphenylphosphoryl)hexane-1,6-dione.
| Compound Name | 1,6-bis(diphenylphosphoryl)hexane-1,6-dione |
|---|---|
| PubChem CID | 58792595 |
| Molecular Formula | C30H28O4P2 |
| Molecular Weight | 514.50 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | 1,6-bis(diphenylphosphoryl)hexane-1,6-dione |
| SMILES | O=C(CCCCC(=O)P(=O)(c1ccccc1)c1ccccc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H28O4P2/c31-29(35(33,25-15-5-1-6-16-25)26-17-7-2-8-18-26)23-13-14-24-30(32)36(34,27-19-9-3-10-20-27)28-21-11-4-12-22-28/h1-12,15-22H,13-14,23-24H2 |
| InChIKey | PNKIGASSTRHHNE-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.50 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|