C32H25O2P — CID 141056133
1-diphenylphosphoryl-2,2,2-triphenylethanone (PubChem CID 141056133) has the molecular formula C32H25O2P and a molecular weight of 472.52 g/mol. Its IUPAC name is 1-diphenylphosphoryl-2,2,2-triphenylethanone.
| Compound Name | 1-diphenylphosphoryl-2,2,2-triphenylethanone |
|---|---|
| PubChem CID | 141056133 |
| Molecular Formula | C32H25O2P |
| Molecular Weight | 472.52 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 1-diphenylphosphoryl-2,2,2-triphenylethanone |
| SMILES | O=C(C(c1ccccc1)(c1ccccc1)c1ccccc1)P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H25O2P/c33-31(35(34,29-22-12-4-13-23-29)30-24-14-5-15-25-30)32(26-16-6-1-7-17-26,27-18-8-2-9-19-27)28-20-10-3-11-21-28/h1-25H |
| InChIKey | KKZUGOXJMLRVPH-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.52 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|