C21H17NO2 — CID 174934653
2-oxo-3,3,3-triphenylpropanamide (PubChem CID 174934653) has the molecular formula C21H17NO2 and a molecular weight of 315.37 g/mol. Its IUPAC name is 2-oxo-3,3,3-triphenylpropanamide.
| Compound Name | 2-oxo-3,3,3-triphenylpropanamide |
|---|---|
| PubChem CID | 174934653 |
| Molecular Formula | C21H17NO2 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 2-oxo-3,3,3-triphenylpropanamide |
| SMILES | NC(=O)C(=O)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H17NO2/c22-20(24)19(23)21(16-10-4-1-5-11-16,17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H,(H2,22,24) |
| InChIKey | FYDNCBCKIIUYIF-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|