C17H18N2O2 — CID 141227643
3,3-diphenylpentanediamide (PubChem CID 141227643) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 3,3-diphenylpentanediamide.
| Compound Name | 3,3-diphenylpentanediamide |
|---|---|
| PubChem CID | 141227643 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 3,3-diphenylpentanediamide |
| SMILES | NC(=O)CC(CC(N)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H18N2O2/c18-15(20)11-17(12-16(19)21,13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10H,11-12H2,(H2,18,20)(H2,19,21) |
| InChIKey | SLWJKUIAXBARDC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |