C17H18N2O4 — CID 142654567
3,3-bis(3-hydroxyphenyl)pentanediamide (PubChem CID 142654567) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is 3,3-bis(3-hydroxyphenyl)pentanediamide.
| Compound Name | 3,3-bis(3-hydroxyphenyl)pentanediamide |
|---|---|
| PubChem CID | 142654567 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 3,3-bis(3-hydroxyphenyl)pentanediamide |
| SMILES | NC(=O)CC(CC(N)=O)(c1cccc(O)c1)c1cccc(O)c1 |
| InChI | InChI=1S/C17H18N2O4/c18-15(22)9-17(10-16(19)23,11-3-1-5-13(20)7-11)12-4-2-6-14(21)8-12/h1-8,20-21H,9-10H2,(H2,18,22)(H2,19,23) |
| InChIKey | GJMOPDBQKLYIPD-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |