2,2-difluoro-2-(3-hydroxyphenyl)acetyl chloride

C8H5ClF2O2 — CID 105459733

IUPAC2,2-difluoro-2-(3-hydroxyphenyl)acetyl chloride
SMILESO=C(Cl)C(F)(F)c1cccc(O)c1
InChIInChI=1S/C8H5ClF2O2/c9-7(13)8(10,11)5-2-1-3-6(12)4-5/h1-4,12H
InChIKeyTUZWOKCKXMDMPI-UHFFFAOYSA-N
MW206.58 g/mol
LogP2.25
Rot. Bonds2

About 2,2-difluoro-2-(3-hydroxyphenyl)acetyl chloride

2,2-difluoro-2-(3-hydroxyphenyl)acetyl chloride (PubChem CID 105459733) has the molecular formula C8H5ClF2O2 and a molecular weight of 206.58 g/mol. Its IUPAC name is 2,2-difluoro-2-(3-hydroxyphenyl)acetyl chloride.

Molecular Properties

Compound Name2,2-difluoro-2-(3-hydroxyphenyl)acetyl chloride
PubChem CID105459733
Molecular FormulaC8H5ClF2O2
Molecular Weight206.58 g/mol
Exact Mass205.99
IUPAC Name2,2-difluoro-2-(3-hydroxyphenyl)acetyl chloride
SMILESO=C(Cl)C(F)(F)c1cccc(O)c1
InChIInChI=1S/C8H5ClF2O2/c9-7(13)8(10,11)5-2-1-3-6(12)4-5/h1-4,12H
InChIKeyTUZWOKCKXMDMPI-UHFFFAOYSA-N
XLogP2.25
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500206.58
LogP ≤ 52.25
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2,2-difluoro-2-(3-hydroxyphenyl)acetyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-difluoro-2-(3-hydroxyphenyl)acetyl chloride?
The IUPAC name of 2,2-difluoro-2-(3-hydroxyphenyl)acetyl chloride (CID 105459733) is 2,2-difluoro-2-(3-hydroxyphenyl)acetyl chloride.
What is the SMILES notation for 2,2-difluoro-2-(3-hydroxyphenyl)acetyl chloride?
The canonical SMILES for 2,2-difluoro-2-(3-hydroxyphenyl)acetyl chloride is O=C(Cl)C(F)(F)c1cccc(O)c1.
What is the InChIKey of 2,2-difluoro-2-(3-hydroxyphenyl)acetyl chloride?
The InChIKey is TUZWOKCKXMDMPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClF2O2/c9-7(13)8(10,11)5-2-1-3-6(12)4-5/h1-4,12H.
What are the key properties of 2,2-difluoro-2-(3-hydroxyphenyl)acetyl chloride?
2,2-difluoro-2-(3-hydroxyphenyl)acetyl chloride has a molecular weight of 206.58 g/mol, XLogP of 2.25, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-2-(3-hydroxyphenyl)acetyl chloride is sourced from PubChem (CID 105459733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).