C8H5ClF2O2 — CID 105459733
2,2-difluoro-2-(3-hydroxyphenyl)acetyl chloride (PubChem CID 105459733) has the molecular formula C8H5ClF2O2 and a molecular weight of 206.58 g/mol. Its IUPAC name is 2,2-difluoro-2-(3-hydroxyphenyl)acetyl chloride.
| Compound Name | 2,2-difluoro-2-(3-hydroxyphenyl)acetyl chloride |
|---|---|
| PubChem CID | 105459733 |
| Molecular Formula | C8H5ClF2O2 |
| Molecular Weight | 206.58 g/mol |
| Exact Mass | 205.99 |
| IUPAC Name | 2,2-difluoro-2-(3-hydroxyphenyl)acetyl chloride |
| SMILES | O=C(Cl)C(F)(F)c1cccc(O)c1 |
| InChI | InChI=1S/C8H5ClF2O2/c9-7(13)8(10,11)5-2-1-3-6(12)4-5/h1-4,12H |
| InChIKey | TUZWOKCKXMDMPI-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.58 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|