2,2-difluoro-2-[4-(trifluoromethyl)phenyl]acetyl chloride

C9H4ClF5O — CID 23365645

IUPAC2,2-difluoro-2-[4-(trifluoromethyl)phenyl]acetyl chloride
SMILESO=C(Cl)C(F)(F)c1ccc(C(F)(F)F)cc1
InChIInChI=1S/C9H4ClF5O/c10-7(16)8(11,12)5-1-3-6(4-2-5)9(13,14)15/h1-4H
InChIKeyMCZGBHXGZMSISV-UHFFFAOYSA-N
MW258.57 g/mol
LogP3.56
Rot. Bonds2

About 2,2-difluoro-2-[4-(trifluoromethyl)phenyl]acetyl chloride

2,2-difluoro-2-[4-(trifluoromethyl)phenyl]acetyl chloride (PubChem CID 23365645) has the molecular formula C9H4ClF5O and a molecular weight of 258.57 g/mol. Its IUPAC name is 2,2-difluoro-2-[4-(trifluoromethyl)phenyl]acetyl chloride.

Molecular Properties

Compound Name2,2-difluoro-2-[4-(trifluoromethyl)phenyl]acetyl chloride
PubChem CID23365645
Molecular FormulaC9H4ClF5O
Molecular Weight258.57 g/mol
Exact Mass257.99
IUPAC Name2,2-difluoro-2-[4-(trifluoromethyl)phenyl]acetyl chloride
SMILESO=C(Cl)C(F)(F)c1ccc(C(F)(F)F)cc1
InChIInChI=1S/C9H4ClF5O/c10-7(16)8(11,12)5-1-3-6(4-2-5)9(13,14)15/h1-4H
InChIKeyMCZGBHXGZMSISV-UHFFFAOYSA-N
XLogP3.56
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.57
LogP ≤ 53.56
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2,2-difluoro-2-[4-(trifluoromethyl)phenyl]acetyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,2-difluoro-2-[4-(trifluoromethyl)phenyl]acetyl chloride?
The IUPAC name of 2,2-difluoro-2-[4-(trifluoromethyl)phenyl]acetyl chloride (CID 23365645) is 2,2-difluoro-2-[4-(trifluoromethyl)phenyl]acetyl chloride.
What is the SMILES notation for 2,2-difluoro-2-[4-(trifluoromethyl)phenyl]acetyl chloride?
The canonical SMILES for 2,2-difluoro-2-[4-(trifluoromethyl)phenyl]acetyl chloride is O=C(Cl)C(F)(F)c1ccc(C(F)(F)F)cc1.
What is the InChIKey of 2,2-difluoro-2-[4-(trifluoromethyl)phenyl]acetyl chloride?
The InChIKey is MCZGBHXGZMSISV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H4ClF5O/c10-7(16)8(11,12)5-1-3-6(4-2-5)9(13,14)15/h1-4H.
What are the key properties of 2,2-difluoro-2-[4-(trifluoromethyl)phenyl]acetyl chloride?
2,2-difluoro-2-[4-(trifluoromethyl)phenyl]acetyl chloride has a molecular weight of 258.57 g/mol, XLogP of 3.56, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-difluoro-2-[4-(trifluoromethyl)phenyl]acetyl chloride is sourced from PubChem (CID 23365645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).