C9H4ClF5O — CID 23365645
2,2-difluoro-2-[4-(trifluoromethyl)phenyl]acetyl chloride (PubChem CID 23365645) has the molecular formula C9H4ClF5O and a molecular weight of 258.57 g/mol. Its IUPAC name is 2,2-difluoro-2-[4-(trifluoromethyl)phenyl]acetyl chloride.
| Compound Name | 2,2-difluoro-2-[4-(trifluoromethyl)phenyl]acetyl chloride |
|---|---|
| PubChem CID | 23365645 |
| Molecular Formula | C9H4ClF5O |
| Molecular Weight | 258.57 g/mol |
| Exact Mass | 257.99 |
| IUPAC Name | 2,2-difluoro-2-[4-(trifluoromethyl)phenyl]acetyl chloride |
| SMILES | O=C(Cl)C(F)(F)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C9H4ClF5O/c10-7(16)8(11,12)5-1-3-6(4-2-5)9(13,14)15/h1-4H |
| InChIKey | MCZGBHXGZMSISV-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.57 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|