C8H7F3O4 — CID 70611467
benzene-1,3-diol;2,2,2-trifluoroacetic acid (PubChem CID 70611467) has the molecular formula C8H7F3O4 and a molecular weight of 224.13 g/mol. Its IUPAC name is benzene-1,3-diol;2,2,2-trifluoroacetic acid.
| Compound Name | benzene-1,3-diol;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 70611467 |
| Molecular Formula | C8H7F3O4 |
| Molecular Weight | 224.13 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | benzene-1,3-diol;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.Oc1cccc(O)c1 |
| InChI | InChI=1S/C6H6O2.C2HF3O2/c7-5-2-1-3-6(8)4-5;3-2(4,5)1(6)7/h1-4,7-8H;(H,6,7) |
| InChIKey | OOEZXWDFBOILIX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.13 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |