C14H9ClF6O5 — CID 175889277
5-chloronaphthalen-2-ol;bis(2,2,2-trifluoroacetic acid) (PubChem CID 175889277) has the molecular formula C14H9ClF6O5 and a molecular weight of 406.66 g/mol. Its IUPAC name is 5-chloronaphthalen-2-ol;bis(2,2,2-trifluoroacetic acid).
| Compound Name | 5-chloronaphthalen-2-ol;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 175889277 |
| Molecular Formula | C14H9ClF6O5 |
| Molecular Weight | 406.66 g/mol |
| Exact Mass | 406.00 |
| IUPAC Name | 5-chloronaphthalen-2-ol;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.Oc1ccc2c(Cl)cccc2c1 |
| InChI | InChI=1S/C10H7ClO.2C2HF3O2/c11-10-3-1-2-7-6-8(12)4-5-9(7)10;2*3-2(4,5)1(6)7/h1-6,12H;2*(H,6,7) |
| InChIKey | GRIVDHKJCHQBTE-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.66 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |