1H-indol-5-ol;2,2,2-trifluoroacetic acid

C10H8F3NO3 — CID 162071647

IUPAC1H-indol-5-ol;2,2,2-trifluoroacetic acid
SMILESO=C(O)C(F)(F)F.Oc1ccc2[nH]ccc2c1
InChIInChI=1S/C8H7NO.C2HF3O2/c10-7-1-2-8-6(5-7)3-4-9-8;3-2(4,5)1(6)7/h1-5,9-10H;(H,6,7)
InChIKeyZBDYIGGQMTZKCE-UHFFFAOYSA-N
MW247.17 g/mol
LogP2.51
Rot. Bonds

About 1H-indol-5-ol;2,2,2-trifluoroacetic acid

1H-indol-5-ol;2,2,2-trifluoroacetic acid (PubChem CID 162071647) has the molecular formula C10H8F3NO3 and a molecular weight of 247.17 g/mol. Its IUPAC name is 1H-indol-5-ol;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Name1H-indol-5-ol;2,2,2-trifluoroacetic acid
PubChem CID162071647
Molecular FormulaC10H8F3NO3
Molecular Weight247.17 g/mol
Exact Mass247.05
IUPAC Name1H-indol-5-ol;2,2,2-trifluoroacetic acid
SMILESO=C(O)C(F)(F)F.Oc1ccc2[nH]ccc2c1
InChIInChI=1S/C8H7NO.C2HF3O2/c10-7-1-2-8-6(5-7)3-4-9-8;3-2(4,5)1(6)7/h1-5,9-10H;(H,6,7)
InChIKeyZBDYIGGQMTZKCE-UHFFFAOYSA-N
XLogP2.51
TPSA73.32 Ų
H-Bond Donors3
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500247.17
LogP ≤ 52.51
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 102

Analyze 1H-indol-5-ol;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1H-indol-5-ol;2,2,2-trifluoroacetic acid?
The IUPAC name of 1H-indol-5-ol;2,2,2-trifluoroacetic acid (CID 162071647) is 1H-indol-5-ol;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 1H-indol-5-ol;2,2,2-trifluoroacetic acid?
The canonical SMILES for 1H-indol-5-ol;2,2,2-trifluoroacetic acid is O=C(O)C(F)(F)F.Oc1ccc2[nH]ccc2c1.
What is the InChIKey of 1H-indol-5-ol;2,2,2-trifluoroacetic acid?
The InChIKey is ZBDYIGGQMTZKCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO.C2HF3O2/c10-7-1-2-8-6(5-7)3-4-9-8;3-2(4,5)1(6)7/h1-5,9-10H;(H,6,7).
What are the key properties of 1H-indol-5-ol;2,2,2-trifluoroacetic acid?
1H-indol-5-ol;2,2,2-trifluoroacetic acid has a molecular weight of 247.17 g/mol, XLogP of 2.51, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indol-5-ol;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 162071647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).