About 1H-indol-6-ol;naphthalene-2-carboxylic acid
1H-indol-6-ol;naphthalene-2-carboxylic acid (PubChem CID 159876966) has the molecular formula C19H15NO3
and a molecular weight of 305.33 g/mol. Its IUPAC name is 1H-indol-6-ol;naphthalene-2-carboxylic acid.
Molecular Properties
| Compound Name | 1H-indol-6-ol;naphthalene-2-carboxylic acid |
| PubChem CID | 159876966 |
| Molecular Formula | C19H15NO3 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 1H-indol-6-ol;naphthalene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc2ccccc2c1.Oc1ccc2cc[nH]c2c1 |
| InChI | InChI=1S/C11H8O2.C8H7NO/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10;10-7-2-1-6-3-4-9-8(6)5-7/h1-7H,(H,12,13);1-5,9-10H |
| InChIKey | NTAJKRAYDHFJDR-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1H-indol-6-ol;naphthalene-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indol-6-ol;naphthalene-2-carboxylic acid?
The IUPAC name of 1H-indol-6-ol;naphthalene-2-carboxylic acid (CID 159876966) is 1H-indol-6-ol;naphthalene-2-carboxylic acid.
What is the SMILES notation for 1H-indol-6-ol;naphthalene-2-carboxylic acid?
The canonical SMILES for 1H-indol-6-ol;naphthalene-2-carboxylic acid is O=C(O)c1ccc2ccccc2c1.Oc1ccc2cc[nH]c2c1.
What is the InChIKey of 1H-indol-6-ol;naphthalene-2-carboxylic acid?
The InChIKey is NTAJKRAYDHFJDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8O2.C8H7NO/c12-11(13)10-6-5-8-3-1-2-4-9(8)7-10;10-7-2-1-6-3-4-9-8(6)5-7/h1-7H,(H,12,13);1-5,9-10H.
What are the key properties of 1H-indol-6-ol;naphthalene-2-carboxylic acid?
1H-indol-6-ol;naphthalene-2-carboxylic acid has a molecular weight of 305.33 g/mol, XLogP of 4.41, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indol-6-ol;naphthalene-2-carboxylic acid is sourced from PubChem (CID 159876966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).