C9H10F3NOS — CID 70289344
benzenethiol;3,3,3-trifluoropropanamide (PubChem CID 70289344) has the molecular formula C9H10F3NOS and a molecular weight of 237.25 g/mol. Its IUPAC name is benzenethiol;3,3,3-trifluoropropanamide.
| Compound Name | benzenethiol;3,3,3-trifluoropropanamide |
|---|---|
| PubChem CID | 70289344 |
| Molecular Formula | C9H10F3NOS |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.04 |
| IUPAC Name | benzenethiol;3,3,3-trifluoropropanamide |
| SMILES | NC(=O)CC(F)(F)F.Sc1ccccc1 |
| InChI | InChI=1S/C6H6S.C3H4F3NO/c7-6-4-2-1-3-5-6;4-3(5,6)1-2(7)8/h1-5,7H;1H2,(H2,7,8) |
| InChIKey | DFOUJJDTPKXHAL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|