C10H7F3O2 — CID 101085965
4,4,4-trifluoro-1-phenylbutane-1,2-dione (PubChem CID 101085965) has the molecular formula C10H7F3O2 and a molecular weight of 216.16 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-phenylbutane-1,2-dione.
| Compound Name | 4,4,4-trifluoro-1-phenylbutane-1,2-dione |
|---|---|
| PubChem CID | 101085965 |
| Molecular Formula | C10H7F3O2 |
| Molecular Weight | 216.16 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 4,4,4-trifluoro-1-phenylbutane-1,2-dione |
| SMILES | O=C(CC(F)(F)F)C(=O)c1ccccc1 |
| InChI | InChI=1S/C10H7F3O2/c11-10(12,13)6-8(14)9(15)7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | KOIJOBHXAWEFJD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.16 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|