C16H13NO — CID 102000055
2,2-diphenylbut-3-ynamide (PubChem CID 102000055) has the molecular formula C16H13NO and a molecular weight of 235.29 g/mol. Its IUPAC name is 2,2-diphenylbut-3-ynamide.
| Compound Name | 2,2-diphenylbut-3-ynamide |
|---|---|
| PubChem CID | 102000055 |
| Molecular Formula | C16H13NO |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 2,2-diphenylbut-3-ynamide |
| SMILES | C#CC(C(N)=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H13NO/c1-2-16(15(17)18,13-9-5-3-6-10-13)14-11-7-4-8-12-14/h1,3-12H,(H2,17,18) |
| InChIKey | SQCFSPSMKUNVOT-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|