C24H24NOSi+ — CID 134873528
3-oxo-2,2,3-triphenyl-N-trimethylsilylpropanenitrilium (PubChem CID 134873528) has the molecular formula C24H24NOSi+ and a molecular weight of 370.55 g/mol. Its IUPAC name is 3-oxo-2,2,3-triphenyl-N-trimethylsilylpropanenitrilium.
| Compound Name | 3-oxo-2,2,3-triphenyl-N-trimethylsilylpropanenitrilium |
|---|---|
| PubChem CID | 134873528 |
| Molecular Formula | C24H24NOSi+ |
| Molecular Weight | 370.55 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 3-oxo-2,2,3-triphenyl-N-trimethylsilylpropanenitrilium |
| SMILES | C[Si](C)(C)[N+]#CC(C(=O)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H24NOSi/c1-27(2,3)25-19-24(21-15-9-5-10-16-21,22-17-11-6-12-18-22)23(26)20-13-7-4-8-14-20/h4-18H,1-3H3/q+1 |
| InChIKey | DECFNSVGNRDYJG-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 21.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.55 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|