C15H11NO2 — CID 87277841
2-hydroxy-3-oxo-2,3-diphenylpropanenitrile (PubChem CID 87277841) has the molecular formula C15H11NO2 and a molecular weight of 237.26 g/mol. Its IUPAC name is 2-hydroxy-3-oxo-2,3-diphenylpropanenitrile.
| Compound Name | 2-hydroxy-3-oxo-2,3-diphenylpropanenitrile |
|---|---|
| PubChem CID | 87277841 |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | 2-hydroxy-3-oxo-2,3-diphenylpropanenitrile |
| SMILES | N#CC(O)(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H11NO2/c16-11-15(18,13-9-5-2-6-10-13)14(17)12-7-3-1-4-8-12/h1-10,18H |
| InChIKey | SGYBJXCFPIYQTL-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|