C16H17O2PS — CID 15146257
2-dimethylphosphinothioyl-2-hydroxy-1,2-diphenylethanone (PubChem CID 15146257) has the molecular formula C16H17O2PS and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-dimethylphosphinothioyl-2-hydroxy-1,2-diphenylethanone.
| Compound Name | 2-dimethylphosphinothioyl-2-hydroxy-1,2-diphenylethanone |
|---|---|
| PubChem CID | 15146257 |
| Molecular Formula | C16H17O2PS |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | 2-dimethylphosphinothioyl-2-hydroxy-1,2-diphenylethanone |
| SMILES | CP(C)(=S)C(O)(C(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H17O2PS/c1-19(2,20)16(18,14-11-7-4-8-12-14)15(17)13-9-5-3-6-10-13/h3-12,18H,1-2H3 |
| InChIKey | DOIVSCBCMDBUNH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|