About [dichloro(phenyl)methyl] carbamate
[dichloro(phenyl)methyl] carbamate (PubChem CID 66779545) has the molecular formula C8H7Cl2NO2
and a molecular weight of 220.06 g/mol. Its IUPAC name is [dichloro(phenyl)methyl] carbamate.
Molecular Properties
| Compound Name | [dichloro(phenyl)methyl] carbamate |
| PubChem CID | 66779545 |
| Molecular Formula | C8H7Cl2NO2 |
| Molecular Weight | 220.06 g/mol |
| Exact Mass | 218.99 |
| IUPAC Name | [dichloro(phenyl)methyl] carbamate |
| SMILES | NC(=O)OC(Cl)(Cl)c1ccccc1 |
| InChI | InChI=1S/C8H7Cl2NO2/c9-8(10,13-7(11)12)6-4-2-1-3-5-6/h1-5H,(H2,11,12) |
| InChIKey | MAZIOXRSAWPYIU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.06 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze [dichloro(phenyl)methyl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dichloro(phenyl)methyl] carbamate?
The IUPAC name of [dichloro(phenyl)methyl] carbamate (CID 66779545) is [dichloro(phenyl)methyl] carbamate.
What is the SMILES notation for [dichloro(phenyl)methyl] carbamate?
The canonical SMILES for [dichloro(phenyl)methyl] carbamate is NC(=O)OC(Cl)(Cl)c1ccccc1.
What is the InChIKey of [dichloro(phenyl)methyl] carbamate?
The InChIKey is MAZIOXRSAWPYIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7Cl2NO2/c9-8(10,13-7(11)12)6-4-2-1-3-5-6/h1-5H,(H2,11,12).
What are the key properties of [dichloro(phenyl)methyl] carbamate?
[dichloro(phenyl)methyl] carbamate has a molecular weight of 220.06 g/mol, XLogP of 2.37, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [dichloro(phenyl)methyl] carbamate is sourced from PubChem (CID 66779545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).