About 2-phenylpropan-2-yl carbamate;triazine
2-phenylpropan-2-yl carbamate;triazine (PubChem CID 175317110) has the molecular formula C13H16N4O2
and a molecular weight of 260.30 g/mol. Its IUPAC name is 2-phenylpropan-2-yl carbamate;triazine.
Molecular Properties
| Compound Name | 2-phenylpropan-2-yl carbamate;triazine |
| PubChem CID | 175317110 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2-phenylpropan-2-yl carbamate;triazine |
| SMILES | CC(C)(OC(N)=O)c1ccccc1.c1cnnnc1 |
| InChI | InChI=1S/C10H13NO2.C3H3N3/c1-10(2,13-9(11)12)8-6-4-3-5-7-8;1-2-4-6-5-3-1/h3-7H,1-2H3,(H2,11,12);1-3H |
| InChIKey | UGGUABRAOWZORL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 90.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-phenylpropan-2-yl carbamate;triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylpropan-2-yl carbamate;triazine?
The IUPAC name of 2-phenylpropan-2-yl carbamate;triazine (CID 175317110) is 2-phenylpropan-2-yl carbamate;triazine.
What is the SMILES notation for 2-phenylpropan-2-yl carbamate;triazine?
The canonical SMILES for 2-phenylpropan-2-yl carbamate;triazine is CC(C)(OC(N)=O)c1ccccc1.c1cnnnc1.
What is the InChIKey of 2-phenylpropan-2-yl carbamate;triazine?
The InChIKey is UGGUABRAOWZORL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2.C3H3N3/c1-10(2,13-9(11)12)8-6-4-3-5-7-8;1-2-4-6-5-3-1/h3-7H,1-2H3,(H2,11,12);1-3H.
What are the key properties of 2-phenylpropan-2-yl carbamate;triazine?
2-phenylpropan-2-yl carbamate;triazine has a molecular weight of 260.30 g/mol, XLogP of 1.89, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylpropan-2-yl carbamate;triazine is sourced from PubChem (CID 175317110), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).