About dichloronickel(2+);[ethyl(phenyl)phosphoryl]benzene
dichloronickel(2+);[ethyl(phenyl)phosphoryl]benzene (PubChem CID 88623036) has the molecular formula C28H28Cl2NiO2P2
and a molecular weight of 588.08 g/mol. Its IUPAC name is dichloronickel(2+);[ethyl(phenyl)phosphoryl]benzene.
Molecular Properties
| Compound Name | dichloronickel(2+);[ethyl(phenyl)phosphoryl]benzene |
| PubChem CID | 88623036 |
| Molecular Formula | C28H28Cl2NiO2P2 |
| Molecular Weight | 588.08 g/mol |
| Exact Mass | 586.03 |
| IUPAC Name | dichloronickel(2+);[ethyl(phenyl)phosphoryl]benzene |
| SMILES | Cl[Ni+2]Cl.[CH2-]CP(=O)(c1ccccc1)c1ccccc1.[CH2-]CP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/2C14H14OP.2ClH.Ni/c2*1-2-16(15,13-9-5-3-6-10-13)14-11-7-4-8-12-14;;;/h2*3-12H,1-2H2;2*1H;/q2*-1;;;+4/p-2 |
| InChIKey | VBAJQXSXYOSACO-UHFFFAOYSA-L |
| XLogP | 7.05 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 588.08 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dichloronickel(2+);[ethyl(phenyl)phosphoryl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloronickel(2+);[ethyl(phenyl)phosphoryl]benzene?
The IUPAC name of dichloronickel(2+);[ethyl(phenyl)phosphoryl]benzene (CID 88623036) is dichloronickel(2+);[ethyl(phenyl)phosphoryl]benzene.
What is the SMILES notation for dichloronickel(2+);[ethyl(phenyl)phosphoryl]benzene?
The canonical SMILES for dichloronickel(2+);[ethyl(phenyl)phosphoryl]benzene is Cl[Ni+2]Cl.[CH2-]CP(=O)(c1ccccc1)c1ccccc1.[CH2-]CP(=O)(c1ccccc1)c1ccccc1.
What is the InChIKey of dichloronickel(2+);[ethyl(phenyl)phosphoryl]benzene?
The InChIKey is VBAJQXSXYOSACO-UHFFFAOYSA-L. The full InChI is InChI=1S/2C14H14OP.2ClH.Ni/c2*1-2-16(15,13-9-5-3-6-10-13)14-11-7-4-8-12-14;;;/h2*3-12H,1-2H2;2*1H;/q2*-1;;;+4/p-2.
What are the key properties of dichloronickel(2+);[ethyl(phenyl)phosphoryl]benzene?
dichloronickel(2+);[ethyl(phenyl)phosphoryl]benzene has a molecular weight of 588.08 g/mol, XLogP of 7.05, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloronickel(2+);[ethyl(phenyl)phosphoryl]benzene is sourced from PubChem (CID 88623036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).