C20H28O2P2 — CID 1378145
[(2-diethylphosphoryl-2-methylpropyl)-phenylphosphoryl]benzene (PubChem CID 1378145) has the molecular formula C20H28O2P2 and a molecular weight of 362.39 g/mol. Its IUPAC name is [(2-diethylphosphoryl-2-methylpropyl)-phenylphosphoryl]benzene.
| Compound Name | [(2-diethylphosphoryl-2-methylpropyl)-phenylphosphoryl]benzene |
|---|---|
| PubChem CID | 1378145 |
| Molecular Formula | C20H28O2P2 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | [(2-diethylphosphoryl-2-methylpropyl)-phenylphosphoryl]benzene |
| SMILES | CCP(=O)(CC)C(C)(C)CP(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H28O2P2/c1-5-23(21,6-2)20(3,4)17-24(22,18-13-9-7-10-14-18)19-15-11-8-12-16-19/h7-16H,5-6,17H2,1-4H3 |
| InChIKey | NSVQTFNRKHDEPM-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|