C23H25O4PS — CID 10342529
(2R,3R)-1-diphenylphosphoryl-4-(4-hydroxyphenyl)sulfanyl-2-methylbutane-2,3-diol (PubChem CID 10342529) has the molecular formula C23H25O4PS and a molecular weight of 428.49 g/mol. Its IUPAC name is (2R,3R)-1-diphenylphosphoryl-4-(4-hydroxyphenyl)sulfanyl-2-methylbutane-2,3-diol.
| Compound Name | (2R,3R)-1-diphenylphosphoryl-4-(4-hydroxyphenyl)sulfanyl-2-methylbutane-2,3-diol |
|---|---|
| PubChem CID | 10342529 |
| Molecular Formula | C23H25O4PS |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | (2R,3R)-1-diphenylphosphoryl-4-(4-hydroxyphenyl)sulfanyl-2-methylbutane-2,3-diol |
| SMILES | C[C@](O)(CP(=O)(c1ccccc1)c1ccccc1)[C@@H](O)CSc1ccc(O)cc1 |
| InChI | InChI=1S/C23H25O4PS/c1-23(26,22(25)16-29-21-14-12-18(24)13-15-21)17-28(27,19-8-4-2-5-9-19)20-10-6-3-7-11-20/h2-15,22,24-26H,16-17H2,1H3/t22-,23-/m0/s1 |
| InChIKey | SGQYCYMTFARSIK-GOTSBHOMSA-N |
| XLogP | 3.61 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|