C18H23O6PS — CID 10046409
[(2S,3R)-4-diphenylphosphoryl-2,3-dihydroxy-3-methylbutyl] methanesulfonate (PubChem CID 10046409) has the molecular formula C18H23O6PS and a molecular weight of 398.42 g/mol. Its IUPAC name is [(2S,3R)-4-diphenylphosphoryl-2,3-dihydroxy-3-methylbutyl] methanesulfonate.
| Compound Name | [(2S,3R)-4-diphenylphosphoryl-2,3-dihydroxy-3-methylbutyl] methanesulfonate |
|---|---|
| PubChem CID | 10046409 |
| Molecular Formula | C18H23O6PS |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | [(2S,3R)-4-diphenylphosphoryl-2,3-dihydroxy-3-methylbutyl] methanesulfonate |
| SMILES | C[C@](O)(CP(=O)(c1ccccc1)c1ccccc1)[C@@H](O)COS(C)(=O)=O |
| InChI | InChI=1S/C18H23O6PS/c1-18(20,17(19)13-24-26(2,22)23)14-25(21,15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,17,19-20H,13-14H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | TUAJIKSYCYCJNQ-ROUUACIJSA-N |
| XLogP | 1.09 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|