C22H25OP — CID 151188674
2-(diphenylphosphorylmethyl)-1,5,5-trimethylcyclohexa-1,3-diene (PubChem CID 151188674) has the molecular formula C22H25OP and a molecular weight of 336.42 g/mol. Its IUPAC name is 2-(diphenylphosphorylmethyl)-1,5,5-trimethylcyclohexa-1,3-diene.
| Compound Name | 2-(diphenylphosphorylmethyl)-1,5,5-trimethylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 151188674 |
| Molecular Formula | C22H25OP |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.16 |
| IUPAC Name | 2-(diphenylphosphorylmethyl)-1,5,5-trimethylcyclohexa-1,3-diene |
| SMILES | CC1=C(CP(=O)(c2ccccc2)c2ccccc2)C=CC(C)(C)C1 |
| InChI | InChI=1S/C22H25OP/c1-18-16-22(2,3)15-14-19(18)17-24(23,20-10-6-4-7-11-20)21-12-8-5-9-13-21/h4-15H,16-17H2,1-3H3 |
| InChIKey | NFVTWOBFVMFSSM-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|