C14H16O — CID 170991368
5,5-dimethyl-2-phenylcyclohexa-1,3-dien-1-ol (PubChem CID 170991368) has the molecular formula C14H16O and a molecular weight of 200.28 g/mol. Its IUPAC name is 5,5-dimethyl-2-phenylcyclohexa-1,3-dien-1-ol.
| Compound Name | 5,5-dimethyl-2-phenylcyclohexa-1,3-dien-1-ol |
|---|---|
| PubChem CID | 170991368 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 5,5-dimethyl-2-phenylcyclohexa-1,3-dien-1-ol |
| SMILES | CC1(C)C=CC(c2ccccc2)=C(O)C1 |
| InChI | InChI=1S/C14H16O/c1-14(2)9-8-12(13(15)10-14)11-6-4-3-5-7-11/h3-9,15H,10H2,1-2H3 |
| InChIKey | CYJRPMQTFFEEAJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |