C13H14ClN — CID 67918445
5-chloro-1-methyl-4-phenylcyclohexa-2,4-dien-1-amine (PubChem CID 67918445) has the molecular formula C13H14ClN and a molecular weight of 219.72 g/mol. Its IUPAC name is 5-chloro-1-methyl-4-phenylcyclohexa-2,4-dien-1-amine.
| Compound Name | 5-chloro-1-methyl-4-phenylcyclohexa-2,4-dien-1-amine |
|---|---|
| PubChem CID | 67918445 |
| Molecular Formula | C13H14ClN |
| Molecular Weight | 219.72 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 5-chloro-1-methyl-4-phenylcyclohexa-2,4-dien-1-amine |
| SMILES | CC1(N)C=CC(c2ccccc2)=C(Cl)C1 |
| InChI | InChI=1S/C13H14ClN/c1-13(15)8-7-11(12(14)9-13)10-5-3-2-4-6-10/h2-8H,9,15H2,1H3 |
| InChIKey | SVEOSNZXOKQRBU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.72 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |