About 1-bromo-4-phenylcyclohexa-3,5-diene-1,3-diol;methane
1-bromo-4-phenylcyclohexa-3,5-diene-1,3-diol;methane (PubChem CID 146598135) has the molecular formula C13H15BrO2
and a molecular weight of 283.17 g/mol. Its IUPAC name is 1-bromo-4-phenylcyclohexa-3,5-diene-1,3-diol;methane.
Molecular Properties
| Compound Name | 1-bromo-4-phenylcyclohexa-3,5-diene-1,3-diol;methane |
| PubChem CID | 146598135 |
| Molecular Formula | C13H15BrO2 |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 282.03 |
| IUPAC Name | 1-bromo-4-phenylcyclohexa-3,5-diene-1,3-diol;methane |
| SMILES | C.OC1=C(c2ccccc2)C=CC(O)(Br)C1 |
| InChI | InChI=1S/C12H11BrO2.CH4/c13-12(15)7-6-10(11(14)8-12)9-4-2-1-3-5-9;/h1-7,14-15H,8H2;1H4 |
| InChIKey | HOTWEFICRKQIIR-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-bromo-4-phenylcyclohexa-3,5-diene-1,3-diol;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-phenylcyclohexa-3,5-diene-1,3-diol;methane?
The IUPAC name of 1-bromo-4-phenylcyclohexa-3,5-diene-1,3-diol;methane (CID 146598135) is 1-bromo-4-phenylcyclohexa-3,5-diene-1,3-diol;methane.
What is the SMILES notation for 1-bromo-4-phenylcyclohexa-3,5-diene-1,3-diol;methane?
The canonical SMILES for 1-bromo-4-phenylcyclohexa-3,5-diene-1,3-diol;methane is C.OC1=C(c2ccccc2)C=CC(O)(Br)C1.
What is the InChIKey of 1-bromo-4-phenylcyclohexa-3,5-diene-1,3-diol;methane?
The InChIKey is HOTWEFICRKQIIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11BrO2.CH4/c13-12(15)7-6-10(11(14)8-12)9-4-2-1-3-5-9;/h1-7,14-15H,8H2;1H4.
What are the key properties of 1-bromo-4-phenylcyclohexa-3,5-diene-1,3-diol;methane?
1-bromo-4-phenylcyclohexa-3,5-diene-1,3-diol;methane has a molecular weight of 283.17 g/mol, XLogP of 3.64, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-phenylcyclohexa-3,5-diene-1,3-diol;methane is sourced from PubChem (CID 146598135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).