C18H14Br4 — CID 141488311
5,5-dibromo-1-(1,4-dibromocyclohexa-2,4-dien-1-yl)-2-phenylcyclohexa-1,3-diene (PubChem CID 141488311) has the molecular formula C18H14Br4 and a molecular weight of 549.93 g/mol. Its IUPAC name is 5,5-dibromo-1-(1,4-dibromocyclohexa-2,4-dien-1-yl)-2-phenylcyclohexa-1,3-diene.
| Compound Name | 5,5-dibromo-1-(1,4-dibromocyclohexa-2,4-dien-1-yl)-2-phenylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 141488311 |
| Molecular Formula | C18H14Br4 |
| Molecular Weight | 549.93 g/mol |
| Exact Mass | 545.78 |
| IUPAC Name | 5,5-dibromo-1-(1,4-dibromocyclohexa-2,4-dien-1-yl)-2-phenylcyclohexa-1,3-diene |
| SMILES | BrC1=CCC(Br)(C2=C(c3ccccc3)C=CC(Br)(Br)C2)C=C1 |
| InChI | InChI=1S/C18H14Br4/c19-14-6-9-17(20,10-7-14)16-12-18(21,22)11-8-15(16)13-4-2-1-3-5-13/h1-9,11H,10,12H2 |
| InChIKey | AOKRMKFSVXQVIK-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.93 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|