C13H10Br2O — CID 151583595
(1,4-dibromocyclohexa-2,4-dien-1-yl)-phenylmethanone (PubChem CID 151583595) has the molecular formula C13H10Br2O and a molecular weight of 342.03 g/mol. Its IUPAC name is (1,4-dibromocyclohexa-2,4-dien-1-yl)-phenylmethanone.
| Compound Name | (1,4-dibromocyclohexa-2,4-dien-1-yl)-phenylmethanone |
|---|---|
| PubChem CID | 151583595 |
| Molecular Formula | C13H10Br2O |
| Molecular Weight | 342.03 g/mol |
| Exact Mass | 339.91 |
| IUPAC Name | (1,4-dibromocyclohexa-2,4-dien-1-yl)-phenylmethanone |
| SMILES | O=C(c1ccccc1)C1(Br)C=CC(Br)=CC1 |
| InChI | InChI=1S/C13H10Br2O/c14-11-6-8-13(15,9-7-11)12(16)10-4-2-1-3-5-10/h1-8H,9H2 |
| InChIKey | QGZWEKOEFPONAG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.03 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|