C15H14BrIO — CID 67441413
(1-bromo-4-iodocyclohexa-2,4-dien-1-yl)-(4-ethylphenyl)methanone (PubChem CID 67441413) has the molecular formula C15H14BrIO and a molecular weight of 417.08 g/mol. Its IUPAC name is (1-bromo-4-iodocyclohexa-2,4-dien-1-yl)-(4-ethylphenyl)methanone.
| Compound Name | (1-bromo-4-iodocyclohexa-2,4-dien-1-yl)-(4-ethylphenyl)methanone |
|---|---|
| PubChem CID | 67441413 |
| Molecular Formula | C15H14BrIO |
| Molecular Weight | 417.08 g/mol |
| Exact Mass | 415.93 |
| IUPAC Name | (1-bromo-4-iodocyclohexa-2,4-dien-1-yl)-(4-ethylphenyl)methanone |
| SMILES | CCc1ccc(C(=O)C2(Br)C=CC(I)=CC2)cc1 |
| InChI | InChI=1S/C15H14BrIO/c1-2-11-3-5-12(6-4-11)14(18)15(16)9-7-13(17)8-10-15/h3-9H,2,10H2,1H3 |
| InChIKey | DBALSMMDYWSZEW-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.08 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|