C13H12BrIO — CID 151406859
2-bromo-5-iodo-5-phenylmethoxycyclohexa-1,3-diene (PubChem CID 151406859) has the molecular formula C13H12BrIO and a molecular weight of 391.05 g/mol. Its IUPAC name is 2-bromo-5-iodo-5-phenylmethoxycyclohexa-1,3-diene.
| Compound Name | 2-bromo-5-iodo-5-phenylmethoxycyclohexa-1,3-diene |
|---|---|
| PubChem CID | 151406859 |
| Molecular Formula | C13H12BrIO |
| Molecular Weight | 391.05 g/mol |
| Exact Mass | 389.91 |
| IUPAC Name | 2-bromo-5-iodo-5-phenylmethoxycyclohexa-1,3-diene |
| SMILES | BrC1=CCC(I)(OCc2ccccc2)C=C1 |
| InChI | InChI=1S/C13H12BrIO/c14-12-6-8-13(15,9-7-12)16-10-11-4-2-1-3-5-11/h1-8H,9-10H2 |
| InChIKey | OXRLRLLFGTYJQZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.05 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|