C11H13NO — CID 141242168
5-phenylmethoxy-2,3-dihydro-1H-pyrrole (PubChem CID 141242168) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 5-phenylmethoxy-2,3-dihydro-1H-pyrrole.
| Compound Name | 5-phenylmethoxy-2,3-dihydro-1H-pyrrole |
|---|---|
| PubChem CID | 141242168 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 5-phenylmethoxy-2,3-dihydro-1H-pyrrole |
| SMILES | C1=C(OCc2ccccc2)NCC1 |
| InChI | InChI=1S/C11H13NO/c1-2-5-10(6-3-1)9-13-11-7-4-8-12-11/h1-3,5-7,12H,4,8-9H2 |
| InChIKey | DCJZWWVWEVBBNW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |