C12H12NO3S- — CID 163872329
6-phenylmethoxy-1,2-dihydropyridine-4-sulfinate (PubChem CID 163872329) has the molecular formula C12H12NO3S- and a molecular weight of 250.30 g/mol. Its IUPAC name is 6-phenylmethoxy-1,2-dihydropyridine-4-sulfinate.
| Compound Name | 6-phenylmethoxy-1,2-dihydropyridine-4-sulfinate |
|---|---|
| PubChem CID | 163872329 |
| Molecular Formula | C12H12NO3S- |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.05 |
| IUPAC Name | 6-phenylmethoxy-1,2-dihydropyridine-4-sulfinate |
| SMILES | O=S([O-])C1=CCNC(OCc2ccccc2)=C1 |
| InChI | InChI=1S/C12H13NO3S/c14-17(15)11-6-7-13-12(8-11)16-9-10-4-2-1-3-5-10/h1-6,8,13H,7,9H2,(H,14,15)/p-1 |
| InChIKey | PMBJIUFJCFJLLL-UHFFFAOYSA-M |
| XLogP | 1.41 |
| TPSA | 61.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|