C14H13BrO2 — CID 156728965
2-bromo-7-phenylmethoxycyclohepta-2,6-dien-1-one (PubChem CID 156728965) has the molecular formula C14H13BrO2 and a molecular weight of 293.16 g/mol. Its IUPAC name is 2-bromo-7-phenylmethoxycyclohepta-2,6-dien-1-one.
| Compound Name | 2-bromo-7-phenylmethoxycyclohepta-2,6-dien-1-one |
|---|---|
| PubChem CID | 156728965 |
| Molecular Formula | C14H13BrO2 |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 2-bromo-7-phenylmethoxycyclohepta-2,6-dien-1-one |
| SMILES | O=C1C(Br)=CCCC=C1OCc1ccccc1 |
| InChI | InChI=1S/C14H13BrO2/c15-12-8-4-5-9-13(14(12)16)17-10-11-6-2-1-3-7-11/h1-3,6-9H,4-5,10H2 |
| InChIKey | NVMHYHNGQUPKJN-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|