C21H20O3 — CID 123279027
2,3-bis(phenylmethoxy)cyclohexa-1,3-diene-1-carbaldehyde (PubChem CID 123279027) has the molecular formula C21H20O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is 2,3-bis(phenylmethoxy)cyclohexa-1,3-diene-1-carbaldehyde.
| Compound Name | 2,3-bis(phenylmethoxy)cyclohexa-1,3-diene-1-carbaldehyde |
|---|---|
| PubChem CID | 123279027 |
| Molecular Formula | C21H20O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 2,3-bis(phenylmethoxy)cyclohexa-1,3-diene-1-carbaldehyde |
| SMILES | O=CC1=C(OCc2ccccc2)C(OCc2ccccc2)=CCC1 |
| InChI | InChI=1S/C21H20O3/c22-14-19-12-7-13-20(23-15-17-8-3-1-4-9-17)21(19)24-16-18-10-5-2-6-11-18/h1-6,8-11,13-14H,7,12,15-16H2 |
| InChIKey | PLXZZXOTOLQWHR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|