C11H12O3 — CID 174881803
6-phenylmethoxy-4H-1,3-dioxine (PubChem CID 174881803) has the molecular formula C11H12O3 and a molecular weight of 192.21 g/mol. Its IUPAC name is 6-phenylmethoxy-4H-1,3-dioxine.
| Compound Name | 6-phenylmethoxy-4H-1,3-dioxine |
|---|---|
| PubChem CID | 174881803 |
| Molecular Formula | C11H12O3 |
| Molecular Weight | 192.21 g/mol |
| Exact Mass | 192.08 |
| IUPAC Name | 6-phenylmethoxy-4H-1,3-dioxine |
| SMILES | C1=C(OCc2ccccc2)OCOC1 |
| InChI | InChI=1S/C11H12O3/c1-2-4-10(5-3-1)8-13-11-6-7-12-9-14-11/h1-6H,7-9H2 |
| InChIKey | YZJCENLCZRWORS-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.21 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |