About 5-phenylmethoxy-2H-pyran
5-phenylmethoxy-2H-pyran (PubChem CID 91151292) has the molecular formula C12H12O2
and a molecular weight of 188.23 g/mol. Its IUPAC name is 5-phenylmethoxy-2H-pyran.
Molecular Properties
| Compound Name | 5-phenylmethoxy-2H-pyran |
| PubChem CID | 91151292 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 5-phenylmethoxy-2H-pyran |
| SMILES | C1=CC(OCc2ccccc2)=COC1 |
| InChI | InChI=1S/C12H12O2/c1-2-5-11(6-3-1)9-14-12-7-4-8-13-10-12/h1-7,10H,8-9H2 |
| InChIKey | LNEUHPDMRMVZQA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-phenylmethoxy-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenylmethoxy-2H-pyran?
The IUPAC name of 5-phenylmethoxy-2H-pyran (CID 91151292) is 5-phenylmethoxy-2H-pyran.
What is the SMILES notation for 5-phenylmethoxy-2H-pyran?
The canonical SMILES for 5-phenylmethoxy-2H-pyran is C1=CC(OCc2ccccc2)=COC1.
What is the InChIKey of 5-phenylmethoxy-2H-pyran?
The InChIKey is LNEUHPDMRMVZQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O2/c1-2-5-11(6-3-1)9-14-12-7-4-8-13-10-12/h1-7,10H,8-9H2.
What are the key properties of 5-phenylmethoxy-2H-pyran?
5-phenylmethoxy-2H-pyran has a molecular weight of 188.23 g/mol, XLogP of 2.63, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenylmethoxy-2H-pyran is sourced from PubChem (CID 91151292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).