C12H11IO — CID 142701456
4-phenylmethoxy-1λ3-iodacyclohexa-1,3,5-triene (PubChem CID 142701456) has the molecular formula C12H11IO and a molecular weight of 298.12 g/mol. Its IUPAC name is 4-phenylmethoxy-1λ3-iodacyclohexa-1,3,5-triene.
| Compound Name | 4-phenylmethoxy-1λ3-iodacyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 142701456 |
| Molecular Formula | C12H11IO |
| Molecular Weight | 298.12 g/mol |
| Exact Mass | 297.99 |
| IUPAC Name | 4-phenylmethoxy-1λ3-iodacyclohexa-1,3,5-triene |
| SMILES | C1=CC(OCc2ccccc2)=CC=I1 |
| InChI | InChI=1S/C12H11IO/c1-2-4-11(5-3-1)10-14-12-6-8-13-9-7-12/h1-9H,10H2 |
| InChIKey | YHKSXIBDSXRUBS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.12 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|