C17H19N3O — CID 142246558
1-methyl-4-phenylmethoxycyclohepta-1,3,5-triene;1H-1,2,4-triazole (PubChem CID 142246558) has the molecular formula C17H19N3O and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-methyl-4-phenylmethoxycyclohepta-1,3,5-triene;1H-1,2,4-triazole.
| Compound Name | 1-methyl-4-phenylmethoxycyclohepta-1,3,5-triene;1H-1,2,4-triazole |
|---|---|
| PubChem CID | 142246558 |
| Molecular Formula | C17H19N3O |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | 1-methyl-4-phenylmethoxycyclohepta-1,3,5-triene;1H-1,2,4-triazole |
| SMILES | CC1=CC=C(OCc2ccccc2)C=CC1.c1nc[nH]n1 |
| InChI | InChI=1S/C15H16O.C2H3N3/c1-13-6-5-9-15(11-10-13)16-12-14-7-3-2-4-8-14;1-3-2-5-4-1/h2-5,7-11H,6,12H2,1H3;1-2H,(H,3,4,5) |
| InChIKey | HBIJUQAQIRXYRQ-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |