C18H19NO4S — CID 135328659
(1-methyl-3-phenylmethoxy-7H-cyclopenta[c]pyridin-4-yl)methyl methanesulfonate (PubChem CID 135328659) has the molecular formula C18H19NO4S and a molecular weight of 345.42 g/mol. Its IUPAC name is (1-methyl-3-phenylmethoxy-7H-cyclopenta[c]pyridin-4-yl)methyl methanesulfonate.
| Compound Name | (1-methyl-3-phenylmethoxy-7H-cyclopenta[c]pyridin-4-yl)methyl methanesulfonate |
|---|---|
| PubChem CID | 135328659 |
| Molecular Formula | C18H19NO4S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | (1-methyl-3-phenylmethoxy-7H-cyclopenta[c]pyridin-4-yl)methyl methanesulfonate |
| SMILES | Cc1nc(OCc2ccccc2)c(COS(C)(=O)=O)c2c1CC=C2 |
| InChI | InChI=1S/C18H19NO4S/c1-13-15-9-6-10-16(15)17(12-23-24(2,20)21)18(19-13)22-11-14-7-4-3-5-8-14/h3-8,10H,9,11-12H2,1-2H3 |
| InChIKey | YNOUMKQGKRKRBI-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|