C17H21BrN2O4S — CID 57235929
[3-bromo-5-(2-methylpropyl)-6-phenylmethoxypyrazin-2-yl]methyl methanesulfonate (PubChem CID 57235929) has the molecular formula C17H21BrN2O4S and a molecular weight of 429.34 g/mol. Its IUPAC name is [3-bromo-5-(2-methylpropyl)-6-phenylmethoxypyrazin-2-yl]methyl methanesulfonate.
| Compound Name | [3-bromo-5-(2-methylpropyl)-6-phenylmethoxypyrazin-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 57235929 |
| Molecular Formula | C17H21BrN2O4S |
| Molecular Weight | 429.34 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | [3-bromo-5-(2-methylpropyl)-6-phenylmethoxypyrazin-2-yl]methyl methanesulfonate |
| SMILES | CC(C)Cc1nc(Br)c(COS(C)(=O)=O)nc1OCc1ccccc1 |
| InChI | InChI=1S/C17H21BrN2O4S/c1-12(2)9-14-17(23-10-13-7-5-4-6-8-13)20-15(16(18)19-14)11-24-25(3,21)22/h4-8,12H,9-11H2,1-3H3 |
| InChIKey | RZKUWNWGYXWVKG-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|