C19H25ClN2O2 — CID 174289987
2-chloro-3-methyl-6-(2-methylpropyl)-5-phenylmethoxypyrazine;prop-1-en-1-ol (PubChem CID 174289987) has the molecular formula C19H25ClN2O2 and a molecular weight of 348.87 g/mol. Its IUPAC name is 2-chloro-3-methyl-6-(2-methylpropyl)-5-phenylmethoxypyrazine;prop-1-en-1-ol.
| Compound Name | 2-chloro-3-methyl-6-(2-methylpropyl)-5-phenylmethoxypyrazine;prop-1-en-1-ol |
|---|---|
| PubChem CID | 174289987 |
| Molecular Formula | C19H25ClN2O2 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 2-chloro-3-methyl-6-(2-methylpropyl)-5-phenylmethoxypyrazine;prop-1-en-1-ol |
| SMILES | CC=CO.Cc1nc(OCc2ccccc2)c(CC(C)C)nc1Cl |
| InChI | InChI=1S/C16H19ClN2O.C3H6O/c1-11(2)9-14-16(18-12(3)15(17)19-14)20-10-13-7-5-4-6-8-13;1-2-3-4/h4-8,11H,9-10H2,1-3H3;2-4H,1H3 |
| InChIKey | ZCHUAPMMHYXGPN-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|