C26H29N3O2 — CID 57176993
3-[[3-methoxy-5-(2-methylpropyl)-6-phenylmethoxypyrazin-2-yl]methyl]-5-methyl-1H-indole (PubChem CID 57176993) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 3-[[3-methoxy-5-(2-methylpropyl)-6-phenylmethoxypyrazin-2-yl]methyl]-5-methyl-1H-indole.
| Compound Name | 3-[[3-methoxy-5-(2-methylpropyl)-6-phenylmethoxypyrazin-2-yl]methyl]-5-methyl-1H-indole |
|---|---|
| PubChem CID | 57176993 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 3-[[3-methoxy-5-(2-methylpropyl)-6-phenylmethoxypyrazin-2-yl]methyl]-5-methyl-1H-indole |
| SMILES | COc1nc(CC(C)C)c(OCc2ccccc2)nc1Cc1c[nH]c2ccc(C)cc12 |
| InChI | InChI=1S/C26H29N3O2/c1-17(2)12-23-26(31-16-19-8-6-5-7-9-19)29-24(25(28-23)30-4)14-20-15-27-22-11-10-18(3)13-21(20)22/h5-11,13,15,17,27H,12,14,16H2,1-4H3 |
| InChIKey | DDRMGKWFJKRKMY-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |