C23H32N2O5S — CID 57296367
[3-cyclohexyloxy-5-(2-methylpropyl)-6-phenylmethoxypyrazin-2-yl]methyl methanesulfonate (PubChem CID 57296367) has the molecular formula C23H32N2O5S and a molecular weight of 448.59 g/mol. Its IUPAC name is [3-cyclohexyloxy-5-(2-methylpropyl)-6-phenylmethoxypyrazin-2-yl]methyl methanesulfonate.
| Compound Name | [3-cyclohexyloxy-5-(2-methylpropyl)-6-phenylmethoxypyrazin-2-yl]methyl methanesulfonate |
|---|---|
| PubChem CID | 57296367 |
| Molecular Formula | C23H32N2O5S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | [3-cyclohexyloxy-5-(2-methylpropyl)-6-phenylmethoxypyrazin-2-yl]methyl methanesulfonate |
| SMILES | CC(C)Cc1nc(OC2CCCCC2)c(COS(C)(=O)=O)nc1OCc1ccccc1 |
| InChI | InChI=1S/C23H32N2O5S/c1-17(2)14-20-22(28-15-18-10-6-4-7-11-18)25-21(16-29-31(3,26)27)23(24-20)30-19-12-8-5-9-13-19/h4,6-7,10-11,17,19H,5,8-9,12-16H2,1-3H3 |
| InChIKey | NKIZNHZWNQIWIT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 87.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|