C19H24N2O3 — CID 91485602
(1-cyclohexyl-3-phenylmethoxypyrazol-4-yl) propanoate (PubChem CID 91485602) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is (1-cyclohexyl-3-phenylmethoxypyrazol-4-yl) propanoate.
| Compound Name | (1-cyclohexyl-3-phenylmethoxypyrazol-4-yl) propanoate |
|---|---|
| PubChem CID | 91485602 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | (1-cyclohexyl-3-phenylmethoxypyrazol-4-yl) propanoate |
| SMILES | CCC(=O)Oc1cn(C2CCCCC2)nc1OCc1ccccc1 |
| InChI | InChI=1S/C19H24N2O3/c1-2-18(22)24-17-13-21(16-11-7-4-8-12-16)20-19(17)23-14-15-9-5-3-6-10-15/h3,5-6,9-10,13,16H,2,4,7-8,11-12,14H2,1H3 |
| InChIKey | CSRNUSOUTDKLSN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |