C21H31ClN4O4 — CID 146446084
benzyl N-[1-(4-aminocyclohexyl)-3-(3-methoxypropoxy)pyrazol-4-yl]carbamate;hydrochloride (PubChem CID 146446084) has the molecular formula C21H31ClN4O4 and a molecular weight of 438.96 g/mol. Its IUPAC name is benzyl N-[1-(4-aminocyclohexyl)-3-(3-methoxypropoxy)pyrazol-4-yl]carbamate;hydrochloride.
| Compound Name | benzyl N-[1-(4-aminocyclohexyl)-3-(3-methoxypropoxy)pyrazol-4-yl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 146446084 |
| Molecular Formula | C21H31ClN4O4 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | benzyl N-[1-(4-aminocyclohexyl)-3-(3-methoxypropoxy)pyrazol-4-yl]carbamate;hydrochloride |
| SMILES | COCCCOc1nn(C2CCC(N)CC2)cc1NC(=O)OCc1ccccc1.Cl |
| InChI | InChI=1S/C21H30N4O4.ClH/c1-27-12-5-13-28-20-19(14-25(24-20)18-10-8-17(22)9-11-18)23-21(26)29-15-16-6-3-2-4-7-16;/h2-4,6-7,14,17-18H,5,8-13,15,22H2,1H3,(H,23,26);1H |
| InChIKey | WSYCKYSUTVTVPG-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|